CAS 1146291-11-3

6-Chloro-1,2,4-triazolo[4,3-b]pyridazine-3-butanoic acid

Description:

6-Chloro-1,2,4-triazolo[4,3-b]pyridazine-3-butanoic acid is a heterocyclic compound characterized by its unique triazole and pyridazine ring structures. This compound features a chlorine atom at the 6-position of the triazole ring, which can influence its reactivity and biological activity. The butanoic acid moiety contributes to its potential as a carboxylic acid, which may participate in various chemical reactions, including esterification and amidation. The presence of both the triazole and pyridazine rings suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. Additionally, the compound's structural features may confer specific properties such as solubility, stability, and lipophilicity, which are critical for drug design. Overall, 6-Chloro-1,2,4-triazolo[4,3-b]pyridazine-3-butanoic acid represents a complex chemical entity with potential applications in various fields, including agrochemicals and pharmaceuticals.

Formula: C₉H₉ClN₄O₂

InChI: InChI=1S/C9H9ClN4O2/c10-6-4-5-8-12-11-7(14(8)13-6)2-1-3-9(15)16/h4-5H,1-3H2,(H,15,16)

InChI key: InChIKey=XARCPAXVULGGQA-UHFFFAOYSA-N

SMILES: C(CCC(O)=O)C=1N2C(=NN1)C=CC(Cl)=N2

Synonyms:

• 1,2,4-Triazolo[4,3-b]pyridazine-3-butanoic acid, 6-chloro-
• 6-Chloro-1,2,4-triazolo[4,3-b]pyridazine-3-butanoic acid