CAS 1146293-67-5

1,2,3,4-Tetrahydro-1,3-dimethyl-2,4-dioxo-7-quinazolinecarboxylic acid

Description:

1,2,3,4-Tetrahydro-1,3-dimethyl-2,4-dioxo-7-quinazolinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a quinazoline ring system. This compound features a tetrahydro configuration, indicating the presence of a saturated cyclic structure, and it contains two carbonyl (C=O) groups, contributing to its dioxo classification. The presence of a carboxylic acid functional group (-COOH) suggests that it can exhibit acidic properties, potentially participating in various chemical reactions, including esterification and neutralization. The dimethyl substituents on the quinazoline ring may influence its solubility and reactivity, making it of interest in medicinal chemistry and drug design. Additionally, the compound's unique structure may impart specific biological activities, which could be explored in pharmacological studies. Overall, this compound's characteristics make it a subject of interest for further research in organic synthesis and potential therapeutic applications.

Formula: C₁₁H₁₀N₂O₄

InChI: InChI=1S/C11H10N2O4/c1-12-8-5-6(10(15)16)3-4-7(8)9(14)13(2)11(12)17/h3-5H,1-2H3,(H,15,16)

InChI key: InChIKey=JIFBFUPUFGYDCN-UHFFFAOYSA-N

SMILES: CN1C=2C(C(=O)N(C)C1=O)=CC=C(C(O)=O)C2

Synonyms:

• 1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydroquinazoline-7-carboxylic acid
• 1,2,3,4-Tetrahydro-1,3-dimethyl-2,4-dioxo-7-quinazolinecarboxylic acid
• 7-Quinazolinecarboxylic acid, 1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-