CAS 1146299-30-0

3-[(1-Pyrrolidinylcarbonyl)amino]benzoic acid

Description:

3-[(1-Pyrrolidinylcarbonyl)amino]benzoic acid, identified by its CAS number 1146299-30-0, is a chemical compound that features a benzoic acid core substituted with a pyrrolidinylcarbonylamino group. This structure suggests it possesses both acidic and basic properties, making it potentially useful in various chemical reactions and applications. The presence of the pyrrolidine ring indicates that the compound may exhibit unique steric and electronic characteristics, which could influence its reactivity and interaction with biological systems. The carboxylic acid functional group contributes to its solubility in polar solvents and may facilitate hydrogen bonding. Additionally, the compound's potential as a pharmaceutical agent could be explored, given its structural motifs that are often associated with bioactivity. Overall, the combination of the aromatic system and the nitrogen-containing heterocycle suggests that this compound may have interesting properties for further research in medicinal chemistry and related fields.

Formula: C₁₂H₁₄N₂O₃

InChI: InChI=1S/C12H14N2O3/c15-11(16)9-4-3-5-10(8-9)13-12(17)14-6-1-2-7-14/h3-5,8H,1-2,6-7H2,(H,13,17)(H,15,16)

InChI key: InChIKey=JPELJAHIAMXPKG-UHFFFAOYSA-N

SMILES: C(NC1=CC(C(O)=O)=CC=C1)(=O)N2CCCC2

Synonyms:

• 3-[(1-Pyrrolidinylcarbonyl)amino]benzoic acid
• Benzoic acid, 3-[(1-pyrrolidinylcarbonyl)amino]-