CAS 114636-30-5
:(S)-(-)-1-BENZYL-3-ACETAMIDOPYRROLIDINE
Description:
(S)-(-)-1-Benzyl-3-acetamidopyrrolidine is a chiral organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound features a benzyl group and an acetamido substituent, contributing to its structural complexity and potential biological activity. The presence of the chiral center indicates that it exists in two enantiomeric forms, with the (S)-(-) designation specifying the configuration of the chiral center. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may exhibit specific interactions with biological targets due to its stereochemistry. Its solubility, stability, and reactivity can vary based on the functional groups present, influencing its behavior in various chemical environments. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, are essential for its identification and characterization in laboratory settings. Overall, (S)-(-)-1-benzyl-3-acetamidopyrrolidine represents a significant structure in the study of chiral compounds and their applications in pharmaceuticals.
Formula:C13H18N2O
InChI:InChI=1/C13H18N2O/c1-11(16)14-13-7-8-15(10-13)9-12-5-3-2-4-6-12/h2-6,13H,7-10H2,1H3,(H,14,16)/t13-/m0/s1
SMILES:CC(=N[C@H]1CCN(Cc2ccccc2)C1)O
Synonyms:- (S)-1-Benzyl-3-Acetylamino Pyrrolidine
- (S)-N-Benzyl-3-AcetylaminoPyrrolidine
- (S)-(-)-1-Benzyl-3-Acetamidopyrrolidine , Ee 99%
- (S)-(-)-1-Benzyl-3-Acetamidopyrrolidine, 98%, Ee 99%
- N-[(3S)-1-benzylpyrrolidin-3-yl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
