CAS 114651-37-5
:4-[(Ethenyloxy)methyl]cyclohexanemethanol
Description:
4-[(Ethenyloxy)methyl]cyclohexanemethanol, identified by its CAS number 114651-37-5, is an organic compound characterized by its unique structure that includes a cyclohexane ring substituted with both an ethenyloxy group and a hydroxymethyl group. This compound is likely to exhibit properties typical of alcohols, such as the ability to form hydrogen bonds, which can influence its solubility in polar solvents like water. The presence of the ethenyloxy group suggests potential reactivity, particularly in polymerization reactions or as a reactive intermediate in organic synthesis. Additionally, the cyclohexane framework may impart certain steric and conformational characteristics that affect its reactivity and interaction with other molecules. The compound's functional groups may also contribute to its potential applications in fields such as materials science, pharmaceuticals, or as a building block in organic synthesis. Overall, its specific physical and chemical properties would depend on factors such as molecular weight, boiling point, and reactivity, which are influenced by its structural features.
Formula:C10H18O2
InChI:InChI=1S/C10H18O2/c1-2-12-8-10-5-3-9(7-11)4-6-10/h2,9-11H,1,3-8H2
InChI key:InChIKey=INRGAWUQFOBNKL-UHFFFAOYSA-N
SMILES:C(OC=C)C1CCC(CO)CC1
Synonyms:- 1,4-Bis(hydroxymethyl)cyclohexane monovinyl ether
- 1,4-Cyclohexanedimethanol vinyl ether,mixture of cis and trans
- 4-(Hydroxymethyl)cyclohexylmethyl vinyl ether
- 4-(Vinyloxymethyl)cyclohexanemethanol
- 4-[(Ethenyloxy)methyl]cyclohexanemethanol
- Cyclohexane-1,4-dimethanol monovinyl ether
- Cyclohexanemethanol, 4-[(ethenyloxy)methyl]-
- Rapi-Cure CHMVE
- [4-[(Vinyloxy)methyl]cyclohexyl]methanol
- {4-[(Ethenyloxy)Methyl]Cyclohexyl}Methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
