CymitQuimica logo

CAS 114662-00-9

:

4-[2-Hydroxy-3-[(1-methylethyl)amino]propoxy]-1,5-naphthalenediol

Description:
4-[2-Hydroxy-3-[(1-methylethyl)amino]propoxy]-1,5-naphthalenediol, with the CAS number 114662-00-9, is a chemical compound characterized by its complex structure, which includes a naphthalene core substituted with hydroxyl groups and an alkylamino side chain. This compound typically exhibits properties associated with both aromatic and alcohol functionalities, contributing to its potential solubility in organic solvents and polar solvents. The presence of the hydroxyl groups suggests it may engage in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the isopropylamino group may impart specific biological activity, making it of interest in pharmaceutical research. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a unique blend of structural features that may confer diverse chemical and biological properties.
Formula:C16H21NO4
InChI:InChI=1S/C16H21NO4/c1-10(2)17-8-11(18)9-21-15-7-6-13(19)12-4-3-5-14(20)16(12)15/h3-7,10-11,17-20H,8-9H2,1-2H3
InChI key:InChIKey=KBQGDOTZGXVBLR-UHFFFAOYSA-N
SMILES:O(CC(CNC(C)C)O)C=1C2=C(C(O)=CC1)C=CC=C2O
Synonyms:
  • 4-[2-Hydroxy-3-[(1-methylethyl)amino]propoxy]-1,5-naphthalenediol
  • 1,5-Naphthalenediol, 4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]-
  • 4,8-Dihydroxypropranolol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.