CAS 114667-79-7
:BU-E 76
Description:
BU-E 76, identified by its CAS number 114667-79-7, is a chemical compound that belongs to the class of substances known as benzyl ureas. It is primarily recognized for its potential applications in medicinal chemistry and as a research tool in various biochemical studies. The compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many organic compounds. BU-E 76 may interact with biological systems, potentially influencing enzyme activity or cellular processes, making it of interest in pharmacological research. However, specific characteristics such as its molecular weight, melting point, and detailed reactivity profiles would require further investigation through experimental data or literature. As with any chemical substance, safety data sheets should be consulted to understand its handling, storage, and potential hazards. Overall, BU-E 76 represents a compound with specific structural features that may contribute to its biological activity and utility in scientific research.
Formula:C21H24F2N6
InChI:InChI=1/C21H24F2N6/c22-16-10-15(11-17(23)12-16)19(20-5-1-2-7-26-20)6-9-28-21(24)27-8-3-4-18-13-25-14-29-18/h1-2,5,7,10-14,19H,3-4,6,8-9H2,(H,25,29)(H3,24,27,28)
SMILES:c1ccnc(c1)C(CCNC(=N)NCCCc1cnc[nH]1)c1cc(cc(c1)F)F
Synonyms:- N(1)-(3-(3,5-Difluorophenyl)-3-pyridine-2-ylpropyl)-N(2)-(3-(1H-imidazol-4-yl)propyl)guanidine
- Guanidine, N-(3-(3,5-difluorophenyl)-3-(2-pyridinyl)propyl)-N'-(3-(1H-imidazol-4-yl)propyl)-
- 1-[3-(3,5-difluorophenyl)-3-pyridin-2-ylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Guanidine, N-[3-(3,5-difluorophenyl)-3-(2-pyridinyl)propyl]-N'-[3-(1H-imidazol-5-yl)propyl]-
CAS:Formula:C21H24F2N6Molecular weight:398.4523
