CAS 1146699-62-8
:4-(Dibromomethyl)-3-fluorobenzonitrile
Description:
4-(Dibromomethyl)-3-fluorobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a nitrile group and halogen atoms. The presence of the dibromomethyl group indicates that two bromine atoms are attached to a carbon adjacent to the nitrile, while the fluorine atom is positioned on the benzene ring, specifically at the meta position relative to the nitrile. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as melting point and solubility that depend on its molecular interactions. The presence of halogens often contributes to increased reactivity, making it useful in various synthetic applications, particularly in the fields of pharmaceuticals and agrochemicals. Additionally, the nitrile functional group can participate in further chemical reactions, such as nucleophilic additions or transformations into other functional groups. Safety data should be consulted, as halogenated compounds can pose health and environmental risks.
Formula:C8H4Br2FN
InChI:InChI=1S/C8H4Br2FN/c9-8(10)6-2-1-5(4-12)3-7(6)11/h1-3,8H
InChI key:InChIKey=UUDQIKQCSRPDKR-UHFFFAOYSA-N
SMILES:C(Br)(Br)C1=C(F)C=C(C#N)C=C1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.