CAS 1146702-54-6
:5-Fluoro-3-phenyl-2-[1-(9H-purin-6-ylamino)propyl]-4(3H)-quinazolinone
Description:
5-Fluoro-3-phenyl-2-[1-(9H-purin-6-ylamino)propyl]-4(3H)-quinazolinone is a synthetic organic compound characterized by its complex structure, which includes a quinazolinone core, a fluorine atom, and a phenyl group. This compound features a purine derivative, indicating potential biological activity, particularly in the realm of medicinal chemistry. The presence of the fluorine atom often enhances the compound's lipophilicity and metabolic stability, which can be advantageous in drug design. The quinazolinone moiety is known for its diverse pharmacological properties, including anti-cancer and anti-inflammatory activities. Additionally, the compound's structure suggests potential interactions with biological targets, making it a candidate for further investigation in therapeutic applications. Its CAS number, 1146702-54-6, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, highlighting its significance in pharmaceutical research.
Formula:C22H18FN7O
InChI:InChI=1S/C22H18FN7O/c1-2-15(28-20-18-19(25-11-24-18)26-12-27-20)21-29-16-10-6-9-14(23)17(16)22(31)30(21)13-7-4-3-5-8-13/h3-12,15H,2H2,1H3,(H2,24,25,26,27,28)
Synonyms:- 5-Fluoro-3-Phenyl-2-[(1S)-1-(9H-Purin-6-Ylamino)Propyl]-4(3H)-Quinazolinone
- CAL-101(Idelalisib)
- (S)-2-(1-((9H-Purin-6-yl)aMino)propyl)-5-fluoro-3-phenylquinazolin-4(3H)-one
- GS-1101
- 5-fluoro-3-phenyl-2-((1s)-1-(1h-purin-6-ylamino)ethyl)-4(3h)-quinazolinone
- CAL-101
- Idelalisib
- GS-1101, Idelalisib
- CAL-101 (GS-1101, Idelalisib)
- 5-fluoro-3-phenyl-2-((1s)-1-(1h-purin-6-ylamino)ethyl)-4(3h)...
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
PI3Kδ-IN-15
CAS:<p>CAL-101 (Idelalisib) is a selective inhibitor of p110δ; shown to have 40- to 300-fold greater selectivity for p110δ than p110α/β/γ.</p>Formula:C21H16FN7OPurity:99.61%Color and Shape:SolidMolecular weight:401.4Idelalisib d5
CAS:<p>Idelalisib d5 is a research tool that binds to the human Activator and Ligand Receptor. The binding of idelalisib d5 to these receptors inhibits the activation of cells. This inhibition may lead to a decrease in the production of cytokines and chemokines, which are molecules involved in inflammation. Idelalisib d5 has been shown to inhibit ion channels, such as chloride channels, and also interacts with other proteins including antibodies and peptides.</p>Formula:C22H18FN7OPurity:Min. 95%Molecular weight:415.4 g/mol



