
CAS 114676-59-4
:D-Proline, 4-hydroxy-, methyl ester, hydrochloride (1:1), (4R)-
Description:
D-Proline, 4-hydroxy-, methyl ester, hydrochloride (1:1), (4R)- is a derivative of the amino acid proline, characterized by the presence of a hydroxyl group at the fourth carbon and a methyl ester functional group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in aqueous solutions. The (4R) designation indicates the specific stereochemistry of the molecule, which is crucial for its biological activity and interactions. D-Proline derivatives are often studied for their roles in peptide synthesis and as potential pharmaceutical agents due to their ability to influence protein structure and function. The presence of the methyl ester group can affect the compound's reactivity and solubility, making it useful in various chemical applications. Additionally, the hydrochloride form provides stability and ease of handling in laboratory settings. Overall, this compound is significant in both synthetic organic chemistry and biochemistry, particularly in the context of drug development and peptide research.
Formula:C6H11NO3·ClH
InChI:InChI=1S/C6H11NO3.ClH/c1-10-6(9)5-2-4(8)3-7-5;/h4-5,7-8H,2-3H2,1H3;1H/t4-,5-;/m1./s1
InChI key:InChIKey=KLGSHNXEUZOKHH-TYSVMGFPSA-N
SMILES:C(OC)(=O)[C@H]1C[C@@H](O)CN1.Cl
Synonyms:- (2R,4R)-4-Hydroxypyrrolidine-2-carboxylic acid methyl ester hydrochloride
- (2R,4R)-Methyl 4-hydroxypyrrolidine-2-carboxylate hydrochloride
- 4-(R)-Hydroxypyrrolidine-2-(R)-carboxylic acid methyl ester hydrochloride
- <span class="text-smallcaps">D</span>-Proline, 4-hydroxy-, methyl ester, hydrochloride (1:1), (4R)-
- <span class="text-smallcaps">D</span>-Proline, 4-hydroxy-, methyl ester, hydrochloride, (4R)-
- <span class="text-smallcaps">D</span>-Proline, 4-hydroxy-, methyl ester, hydrochloride, cis-
- methyl (2R,4R)-4-hydroxypyrrolidine-2-carboxylate hydrochloride
- D-Proline, 4-hydroxy-, methyl ester, hydrochloride (1:1), (4R)-
- D-Proline, 4-hydroxy-, methyl ester, hydrochloride, (4R)-
- D-Proline, 4-hydroxy-, methyl ester, hydrochloride, cis-
- (2R,4R)-cis-4-hydroxy-D-proline methyl ester hydrochloride
- D-Proline, 4-hydroxy-, methyl ester, hydrochloride (1
- D-Proline, 4-Hydroxy
- D-Proline, 4-hydroxy-, methyl ester (hydrochloride)
- Cis-D-Hyp-OMe.HC
- D-Proline, 4-hydroxy-, methyl ester, hydrochloride (1:1), (4...
- Methyl cis-4-Hydroxy-D-proline Hydrochloride
- Cis-4-hydroxy-proline Methyl ester hydrochloride -D-
- (2R,4R)-4-Hydroxy-2-(methoxycarbonyl)pyrrolidine hydrochloride, cis-4-Hydroxy-D-proline methyl ester hydrochloride
- Cis-D-Hyp-OMe.HCl
- Cis-4-Hydroxy-D-proline Methyl ester HCl
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2R,4R)-Methyl 4-hydroxypyrrolidine-2-carboxylate HCl
CAS:Formula:C6H12ClNO3Purity:97%Color and Shape:SolidMolecular weight:181.6174Methyl (2R,4R)-4-hydroxypyrrolidine-2-carboxylate hydrochloride
CAS:<p>Methyl (2R,4R)-4-hydroxypyrrolidine-2-carboxylate hydrochloride</p>Formula:C6H11NO3·ClHPurity:≥95%Color and Shape: white solidMolecular weight:181.62g/mol(2R,4R)-Methyl 4-hydroxypyrrolidine-2-carboxylate hydrochloride
CAS:Formula:C6H12ClNO3Purity:97%Color and Shape:SolidMolecular weight:181.62


