CAS 114676-84-5
:7-(4'-amino-2'-methylpyrrolidinyl)-1-(2,4-difluorophenyl)-1,4-dihydro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid
Description:
The chemical substance known as 7-(4'-amino-2'-methylpyrrolidinyl)-1-(2,4-difluorophenyl)-1,4-dihydro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid, with the CAS number 114676-84-5, is a synthetic compound that belongs to the class of naphthyridine derivatives. This compound is characterized by its complex molecular structure, which includes a naphthyridine core, a carboxylic acid functional group, and various substituents that contribute to its pharmacological properties. The presence of fluorine atoms in the structure often enhances the compound's biological activity and lipophilicity, potentially influencing its interaction with biological targets. The amino and pyrrolidine groups may also play a crucial role in modulating the compound's pharmacodynamics and pharmacokinetics. Such compounds are typically investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development, where they may exhibit antibacterial or antiviral properties. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.
Formula:C20H17F3N4O3
InChI:InChI=1/C20H17F3N4O3/c1-9-4-11(24)7-26(9)19-15(23)6-12-17(28)13(20(29)30)8-27(18(12)25-19)16-3-2-10(21)5-14(16)22/h2-3,5-6,8-9,11H,4,7,24H2,1H3,(H,29,30)/t9-,11-/m0/s1
SMILES:C[C@H]1C[C@@H](CN1c1c(cc2c(=O)c(cn(c3ccc(cc3F)F)c2n1)C(=O)O)F)N
Synonyms:- Addnc
- 7-[(2S,4S)-4-amino-2-methylpyrrolidin-1-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid
- 7-(4'-Amino-2'-methylpyrrolidinyl)-1-(2,4-difluorophenyl)-1,4-dihydro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,8-Naphthyridine-3-carboxylic acid, 7-(4-amino-2-methyl-1-pyrrolidinyl)-1-(2,4-difluorophenyl)-6-fluoro-1,4-dihydro-4-oxo-, (2S-trans)- (9CI)
CAS:Formula:C20H17F3N4O3Molecular weight:418.3692
