CAS 114686-85-0

2,3-Dichlorophenethylalcohol

Description:

2,3-Dichlorophenethylalcohol is an organic compound characterized by its phenethyl alcohol structure, which features a phenyl ring substituted with two chlorine atoms at the 2 and 3 positions. This compound is typically a colorless to pale yellow liquid with a moderate boiling point and is soluble in organic solvents. Its molecular structure includes a hydroxyl (-OH) group, which contributes to its alcohol properties, making it a potential candidate for various chemical reactions, including esterification and oxidation. The presence of chlorine substituents enhances its reactivity and may impart specific biological activities, making it of interest in pharmaceutical and agrochemical research. Additionally, the compound's properties can be influenced by the steric and electronic effects of the chlorine atoms, which can affect its interactions with biological systems. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 2,3-Dichlorophenethylalcohol is a compound of interest in both synthetic chemistry and potential applications in various fields.

Formula: C₈H₈Cl₂O

InChI: InChI=1/C8H8Cl2O/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3,11H,4-5H2

SMILES: c1cc(CCO)c(c(c1)Cl)Cl

Synonyms:

• 2-(2,3-Dichlorophenyl)Ethanol

Benzeneethanol, 2,3-dichloro-

CAS: 114686-85-0

Formula: C₈H₈Cl₂O

Purity: 96%

Color and Shape: Liquid

Molecular weight: 191.0545

Ref: IN-DA000F1O

2,3-Dichlorobenzeneethanol

CAS: 114686-85-0

2,3-Dichlorobenzeneethanol

Purity: 98%

Color and Shape: Solid

Molecular weight: 191.06g/mol

Ref: 54-OR918460

2-(2,3-Dichlorophenyl)ethanol

CAS: 114686-85-0

Formula: C₈H₈Cl₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.05

Ref: 10-F210120