CAS 114701-62-1
:2,2-DIFLUORO-3-OXO-3-PHENYL-PROPIONIC ACID ETHYL ESTER
Description:
2,2-Difluoro-3-oxo-3-phenyl-propionic acid ethyl ester, identified by its CAS number 114701-62-1, is an organic compound characterized by the presence of a propionic acid backbone with a phenyl group and two fluorine atoms attached to the second carbon. This compound typically exhibits a white to off-white crystalline solid form and is soluble in organic solvents, reflecting its ester functional group. The difluoromethyl substituents contribute to its unique chemical reactivity and potential applications in pharmaceuticals and agrochemicals. The presence of the phenyl group enhances its lipophilicity, which may influence its biological activity and interaction with various biological targets. Additionally, the keto group (3-oxo) plays a significant role in its reactivity, potentially participating in various chemical transformations. Overall, this compound's structural features suggest it may possess interesting properties for further research in medicinal chemistry and synthetic applications.
Formula:C11H10F2O3
InChI:InChI=1/C11H10F2O3/c1-2-16-10(15)11(12,13)9(14)8-6-4-3-5-7-8/h3-7H,2H2,1H3
SMILES:CCOC(=O)C(C(=O)c1ccccc1)(F)F
Synonyms:- Benzoyldifluoroacetic Acid, Ethyl Ester
- Ethyl 2,2-Difluoro-3-Oxo-3-Phenylpropanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
