CAS 114703-12-7: 7-Bromoquinazoline-2,4(1H,3H)-dione

Description:7-Bromoquinazoline-2,4(1H,3H)-dione is a heterocyclic organic compound characterized by its quinazoline core, which features a bromine substituent at the 7-position and two carbonyl groups at the 2 and 4 positions. This compound is typically classified as a derivative of quinazoline, a bicyclic structure known for its presence in various biologically active molecules. The presence of the bromine atom enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The dione functional groups contribute to its potential as a ligand in coordination chemistry and may also play a role in its interactions with biological targets. In terms of solubility, compounds of this nature often exhibit moderate solubility in organic solvents, while their stability can be influenced by environmental factors such as pH and temperature. Overall, 7-Bromoquinazoline-2,4(1H,3H)-dione is a compound of interest for research in pharmaceuticals and materials science due to its unique structural features and potential applications.

Formula:C₈H₅BrN₂O₂

InChI:InChI=1/C8H5BrN2O2/c9-4-1-2-5-6(3-4)10-8(13)11-7(5)12/h1-3H,(H2,10,11,12,13)

Synonyms:
2,4-Quinazolinediol, 7-bromo-
7-Bromoquinazoline-2,4-Diol

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2,4(1H,3H)-Quinazolinedione, 7-bromo- REF: IN-DA000F32CAS: 114703-12-7	98%	25.00 €~185.00 €	Tue 04 Mar 25
7-Bromo-2,4(1H,3H)-quinazolinedione REF: 54-OR1012061CAS: 114703-12-7	97%+	32.00 €~1,144.00 €	Mon 03 Mar 25
7-Bromoquinazoline-2,4(1H,3H)-Dione REF: TM-TN7192CAS: 114703-12-7	97.39%	35.00 €~246.00 €	Mon 03 Mar 25
7-Bromoquinazoline-2,4-diol REF: 10-F092145CAS: 114703-12-7	95.0%	20.00 €~228.00 €	Wed 05 Mar 25
7-Bromoquinazoline-2,4-diol REF: 3D-FB43464CAS: 114703-12-7	Min. 95%	- - -	Discontinued product