CAS 114703-80-9

2-Azido-N-cyclohexylacetamide

Description:

2-Azido-N-cyclohexylacetamide is an organic compound characterized by the presence of an azido group (-N3) and a cyclohexylacetamide moiety. It typically appears as a solid at room temperature and is known for its potential applications in organic synthesis and materials science, particularly in the development of energetic materials due to the azido functional group, which can impart explosive properties under certain conditions. The compound is soluble in polar organic solvents, and its reactivity is influenced by the azido group, which can undergo various transformations, including reduction and cycloaddition reactions. Safety precautions are essential when handling this compound, as azides can be sensitive to heat, shock, and friction, posing risks of detonation. Additionally, the cyclohexyl group contributes to the compound's hydrophobic characteristics, affecting its interaction with biological systems and other chemical entities. Overall, 2-Azido-N-cyclohexylacetamide is a notable compound in the field of synthetic chemistry, with unique properties stemming from its functional groups.

Formula: C₈H₁₄N₄O

InChI: InChI=1S/C8H14N4O/c9-12-10-6-8(13)11-7-4-2-1-3-5-7/h7H,1-6H2,(H,11,13)

InChI key: InChIKey=VQWVXWLYRATMFA-UHFFFAOYSA-N

SMILES: N(C(CN=[N+]=[N-])=O)C1CCCCC1

Synonyms:

• 2-Azido-N-cyclohexylacetamide
• Cyclohexylaminocarbonylmethyl azide
• Acetamide, 2-azido-N-cyclohexyl-