CAS 1147103-54-5
:(3aR,6aS)-Tetrahydro-2-(phenylmethyl)cyclopenta[c]pyrrole-1,3(2H,3aH)-dione
Description:
(3aR,6aS)-Tetrahydro-2-(phenylmethyl)cyclopenta[c]pyrrole-1,3(2H,3aH)-dione is a chemical compound characterized by its unique bicyclic structure, which includes a cyclopentane ring fused to a pyrrole moiety. This compound features a phenylmethyl substituent, contributing to its aromatic properties and potentially influencing its reactivity and interactions. The stereochemistry indicated by the (3aR,6aS) designation suggests specific spatial arrangements of atoms, which can significantly affect the compound's biological activity and physical properties. As a diketone, it contains two carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The presence of these functional groups may also enhance its potential as a pharmacophore in medicinal chemistry. Overall, this compound's structural complexity and functional groups make it of interest in organic synthesis and potentially in drug development, although specific applications would depend on further research into its biological activity and interactions.
Formula:C14H15NO2
InChI:InChI=1S/C14H15NO2/c16-13-11-7-4-8-12(11)14(17)15(13)9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9H2/t11-,12+
InChI key:InChIKey=MIVQUQMOPVQLCZ-TXEJJXNPSA-N
SMILES:O=C1[C@@]2([C@](C(=O)N1CC3=CC=CC=C3)(CCC2)[H])[H]
Synonyms:- (3aR,6aS)-Tetrahydro-2-(phenylmethyl)cyclopenta[c]pyrrole-1,3(2H,3aH)-dione
- Cyclopenta[c]pyrrole-1,3(2H,3aH)-dione, tetrahydro-2-(phenylmethyl)-, (3aR,6aS)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.