CymitQuimica logo

CAS 114715-56-9

:

Pentanoic acid, 3-hydroxy-2-methyl-, 1-ethylpropyl ester, (R*,R*)-

Description:
Pentanoic acid, 3-hydroxy-2-methyl-, 1-ethylpropyl ester, with the CAS number 114715-56-9, is an organic compound characterized by its ester functional group, which is formed from the reaction of pentanoic acid and an alcohol. This compound features a branched structure, indicated by the presence of a hydroxy group and a methyl group on the pentanoic acid backbone. The (R*,R*) notation suggests that it has specific stereochemistry, indicating the spatial arrangement of its atoms, which can influence its chemical behavior and interactions. Generally, esters like this one are known for their pleasant odors and are often used in flavoring and fragrance applications. They may also exhibit solubility in organic solvents and varying degrees of polarity, depending on their structure. The presence of the hydroxy group can impart additional properties, such as increased hydrogen bonding capabilities, which may affect its boiling point and solubility in water. Overall, this compound's unique structure contributes to its potential applications in various chemical and industrial processes.
Formula:C11H22O3
InChI:InChI=1/C11H22O3/c1-5-9(6-2)14-11(13)8(4)10(12)7-3/h8-10,12H,5-7H2,1-4H3/t8-,10-/s2
InChI key:InChIKey=JZOCRUBSQNZLIW-CSEYRULYNA-N
SMILES:C(OC([C@@H]([C@@H](CC)O)C)=O)(CC)CC
Synonyms:
  • Pentanoic acid, 3-hydroxy-2-methyl-, 1-ethylpropyl ester, (R*,R*)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.