CAS 114716-83-5
:5-deoxy-5-fluoroinositol
Description:
5-Deoxy-5-fluoroinositol is a fluorinated derivative of inositol, characterized by the substitution of a fluorine atom at the 5-position of the inositol ring. This modification alters its chemical properties and biological activity compared to its parent compound, inositol. The presence of the fluorine atom can enhance the compound's stability and influence its interaction with biological targets, making it of interest in medicinal chemistry and research. Typically, inositol derivatives are involved in various cellular processes, including signal transduction and osmoregulation. The specific structural features of 5-deoxy-5-fluoroinositol may also affect its solubility, reactivity, and potential applications in pharmaceuticals or as a biochemical probe. As with many fluorinated compounds, it may exhibit unique pharmacokinetic properties, which could be beneficial in drug design. However, detailed studies are necessary to fully understand its biological implications and potential therapeutic uses.
Formula:C6H11FO5
InChI:InChI=1/C6H11FO5/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6,8-12H/t1?,2-,3+,4+,5-,6?
Synonyms:- 5-Deoxy-5-fluoro-myo-inositol
- (1R,2S,4R,5S)-6-fluorocyclohexane-1,2,3,4,5-pentol
- 5-Deoxy-5-fluoroinositol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
