CAS 1147181-19-8
:4-(Ethylsulfonyl)piperidine
Description:
4-(Ethylsulfonyl)piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the ethylsulfonyl group at the 4-position of the piperidine ring introduces a sulfonyl functional group, which enhances the compound's polarity and solubility in polar solvents. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of pharmaceuticals due to its ability to interact with biological targets. The sulfonyl group can also influence the compound's reactivity and stability, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-(Ethylsulfonyl)piperidine is an interesting compound with diverse applications in chemical research and development.
Formula:C7H15NO2S
InChI:InChI=1S/C7H15NO2S/c1-2-11(9,10)7-3-5-8-6-4-7/h7-8H,2-6H2,1H3
InChI key:InChIKey=JMYXSHLCNUBQQY-UHFFFAOYSA-N
SMILES:S(CC)(=O)(=O)C1CCNCC1
Synonyms:- Piperidine, 4-(ethylsulfonyl)-
- 4-(Ethylsulfonyl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
