CAS 114724-41-3

2-[(2-AMINOPHENYL)THIO]BENZOIC ACID HYDROCHLORIDE

Description:

2-[(2-Aminophenyl)thio]benzoic acid hydrochloride, with the CAS number 114724-41-3, is a chemical compound characterized by its aromatic structure, which includes a benzoic acid moiety and an amino group attached to a phenyl ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it useful in various chemical applications. The presence of the amino group suggests potential for hydrogen bonding and reactivity, while the thioether linkage may impart unique chemical properties, such as increased stability or altered reactivity compared to similar compounds. Its hydrochloride form indicates that it is a salt, which can enhance its solubility and stability in solution. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways, due to its structural features that could interact with biological molecules. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₁₃H₁₂ClNO₂S

InChI: InChI=1/C13H11NO2S.ClH/c14-10-6-2-4-8-12(10)17-11-7-3-1-5-9(11)13(15)16;/h1-8H,14H2,(H,15,16);1H

SMILES: c1ccc(c(c1)C(=O)O)Sc1ccccc1N.Cl

Synonyms:

• 2-[(2-Aminophenyl)thio]benzoicacidHCl
• 2-[(2-Aminophenyl)Sulfanyl]Benzoic Acid Hydrochloride

2-((2-Aminophenyl)thio)benzoic acid hydrochloride

CAS: 114724-41-3

Formula: C₁₃H₁₂ClNO₂S

Molecular weight: 281.7579

Ref: IN-DA008SJO

2-(2-Aminophenylthio)benzoic Acid Hydrochloride

Controlled Product

CAS: 114724-41-3

Formula: C₁₃H₁₁NO₂S•HCl

Color and Shape: Neat

Molecular weight: 245.30 + (36.46)

Ref: TR-A638138

2-[(2-Aminophenyl)sulfanyl]benzoic acid hydrochloride

CAS: 114724-41-3

Versatile small molecule scaffold

Formula: C₁₃H₁₂ClNO₂S

Purity: Min. 95%

Molecular weight: 281.76 g/mol

Ref: 3D-PEA72441