CAS 114725-01-8

1-Azabicyclo[2.2.2]octan-3-one, 2-methyl-, hydrochloride (1:1)

Description:

1-Azabicyclo[2.2.2]octan-3-one, 2-methyl-, hydrochloride (1:1), commonly referred to as a bicyclic compound, features a bicyclic structure that includes a nitrogen atom within its ring system. This compound is characterized by its unique bicyclic framework, which contributes to its potential biological activity. The presence of the hydrochloride indicates that it is a salt form, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The nitrogen atom in the structure can participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. Additionally, the methyl group at the 2-position can affect the compound's steric and electronic properties, potentially impacting its pharmacological profile. Overall, this compound's structural characteristics suggest it may have interesting properties for further research in medicinal chemistry and drug development. However, specific biological activities and applications would require further investigation and empirical data.

Formula: C₈H₁₃NO·ClH

InChI: InChI=1S/C8H13NO.ClH/c1-6-8(10)7-2-4-9(6)5-3-7;/h6-7H,2-5H2,1H3;1H

InChI key: InChIKey=YQTAQJRDVMECNM-UHFFFAOYSA-N

SMILES: O=C1C2CCN(C1C)CC2.Cl

Synonyms:

• 1-Azabicyclo[2.2.2]octan-3-one, 2-methyl-, hydrochloride (1:1)
• 1-Azabicyclo[2.2.2]octan-3-one, 2-methyl-, hydrochloride

2-methyl-1-azabicyclo[2.2.2]octan-3-one hydrochloride

CAS: 114725-01-8

Formula: C₈H₁₄ClNO

Molecular weight: 175.6559

Ref: IN-DA000F4B

2-Methyl-1-azabicyclo[2.2.2]octan-3-one hydrochloride

CAS: 114725-01-8

Versatile small molecule scaffold

Formula: C₈H₁₄ClNO

Purity: Min. 95%

Molecular weight: 175.65 g/mol

Ref: 3D-PEA72501