CAS 114744-52-4

1-(4-Bromo-2,3-dihydro-1H-indol-1-yl)ethanone

Description:

1-(4-Bromo-2,3-dihydro-1H-indol-1-yl)ethanone, with the CAS number 114744-52-4, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 4-position of the indole ring introduces notable electrophilic properties, enhancing its reactivity in various chemical reactions. The ethanone functional group contributes to its potential as a ketone, making it a candidate for further derivatization. This compound may exhibit biological activity, as many indole derivatives are known for their pharmacological properties, including anti-inflammatory and anticancer effects. Its solubility and stability can vary depending on the solvent and environmental conditions. Additionally, the compound's synthesis typically involves multi-step organic reactions, which may include bromination and acylation processes. Overall, 1-(4-Bromo-2,3-dihydro-1H-indol-1-yl)ethanone is of interest in both synthetic organic chemistry and medicinal chemistry due to its structural features and potential applications.

Formula: C₁₀H₁₀BrNO

InChI: InChI=1S/C10H10BrNO/c1-7(13)12-6-5-8-9(11)3-2-4-10(8)12/h2-4H,5-6H2,1H3

InChI key: InChIKey=SQTJOHUYRUNCDT-UHFFFAOYSA-N

SMILES: C(C)(=O)N1C=2C(CC1)=C(Br)C=CC2

Synonyms:

• 1-Acetyl-4-bromoindoline
• 1-(4-Bromo-2,3-dihydro-1H-indol-1-yl)ethanone
• 1-(4-Bromoindolin-1-yl)ethanone
• 1H-Indole, 1-acetyl-4-bromo-2,3-dihydro-
• Ethanone, 1-(4-bromo-2,3-dihydro-1H-indol-1-yl)-

1-(4-Bromoindolin-1-yl)ethanone

CAS: 114744-52-4

Formula: C₁₀H₁₀BrNO

Molecular weight: 240.0965

Ref: IN-DA000F51