CAS 114746-66-6
:3-(Piperazin-1-ylmethyl)-1H-indole
Description:
3-(Piperazin-1-ylmethyl)-1H-indole is a chemical compound characterized by its indole core, which is a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. The presence of a piperazine moiety, a six-membered ring containing two nitrogen atoms, contributes to its potential biological activity and solubility properties. This compound is often studied for its pharmacological properties, particularly in the context of drug development, as indole derivatives are known to exhibit a range of biological activities, including antipsychotic and antidepressant effects. The piperazine group can enhance interactions with biological targets, such as receptors or enzymes, making it a valuable scaffold in medicinal chemistry. Additionally, the compound's structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability. Overall, 3-(Piperazin-1-ylmethyl)-1H-indole represents a significant class of compounds with potential therapeutic applications, warranting further investigation into its properties and mechanisms of action.
Formula:C13H17N3
InChI:InChI=1/C13H17N3/c1-2-4-13-12(3-1)11(9-15-13)10-16-7-5-14-6-8-16/h1-4,9,14-15H,5-8,10H2
SMILES:c1ccc2c(c1)c(c[nH]2)CN1CCNCC1
Synonyms:- 1H-Indole, 3-(1-piperazinylmethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-(1-Piperazinylmethyl)indole, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C13H17N3Purity:95%Molecular weight:215.293-(Piperazin-1-ylmethyl)-1H-indole
CAS:Formula:C13H17N3Color and Shape:SolidMolecular weight:215.2942

