CAS 114748-57-1
:2',3'-dideoxy-3'-iodocytidine
Description:
2',3'-Dideoxy-3'-iodocytidine is a nucleoside analog that plays a significant role in antiviral and anticancer research. This compound is characterized by the absence of a hydroxyl group at the 2' and 3' positions of the ribose sugar, which distinguishes it from standard nucleosides. The presence of an iodine atom at the 3' position enhances its potential as a therapeutic agent, as it can interfere with nucleic acid synthesis and function. The molecular structure allows it to mimic natural nucleosides, making it a valuable tool in studying viral replication and cellular processes. Its mechanism of action often involves incorporation into viral RNA or DNA, leading to chain termination during replication. Additionally, the compound's unique properties may contribute to its effectiveness against certain viral infections and tumors. As with many nucleoside analogs, the pharmacokinetics, bioavailability, and toxicity profiles are critical for its development as a therapeutic agent. Overall, 2',3'-dideoxy-3'-iodocytidine represents an important area of research in medicinal chemistry and virology.
Formula:C9H12IN3O3
InChI:InChI=1/C9H12IN3O3/c10-5-3-8(16-6(5)4-14)13-2-1-7(11)12-9(13)15/h1-2,5-6,8,14H,3-4H2,(H2,11,12,15)/t5-,6+,8+/m0/s1
Synonyms:- 5'-Iodo-2',3'-dideoxycytidine
- 5-Iodo-2',3'-Dideoxy-D-Cytidine
- 5-I-ddC
- 2',3'-Dideoxy-5-iodocytidine
- 1-((S)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-4-imino-5-iodo-3,4-dihydro-1H-pyrimidin-2-one
- 5-Iodo-2’,3’-dideoxycytidine, , IddC
- Cytidine, 2',3'-dideoxy-5-iodo-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Cytidine, 2',3'-dideoxy-5-iodo-
CAS:Formula:C9H12IN3O3Purity:99%Color and Shape:SolidMolecular weight:337.11432',3'-Dideoxy-5-iodocytidine
CAS:2',3'-Dideoxy-5-iodocytidine, used in gene sequencing, acts as an antibiotic effective against Mycobacterium.Formula:C9H12IN3O3Color and Shape:SolidMolecular weight:337.112',3'-Dideoxy-5-iodocytidine
CAS:2',3'-Dideoxy-5-iodocytidine is a modified nucleoside analog based on cytidine, one of the four standard nucleosides found in DNA and RNA. It has been chemically altered to interfere with DNA or RNA synthesis, making it potentially useful as an antiviral or anticancer agent.
Formula:C9H12N3IO3Purity:Min. 95%Molecular weight:337.11 g/mol




