CAS 114753-53-6
:3'-fluoro-2,6-diaminopurine-2',3'-dideoxyriboside
Description:
3'-Fluoro-2,6-diaminopurine-2',3'-dideoxyriboside is a synthetic nucleoside analog that exhibits structural similarities to natural purine nucleosides. This compound features a fluorine atom at the 3' position of the ribose sugar, which can influence its biological activity and stability. The presence of two amino groups at the 2 and 6 positions of the purine base enhances its potential for interactions with nucleic acid targets. As a dideoxynucleoside, it lacks the hydroxyl group at the 2' and 3' positions of the ribose, which is crucial for DNA chain elongation, making it a potential inhibitor of viral replication and a candidate for antiviral therapies. The compound's unique structure allows it to interfere with nucleic acid synthesis, thus providing a mechanism for its therapeutic applications. Its CAS number, 114753-53-6, is a unique identifier that facilitates the tracking and study of this compound in scientific literature and databases. Overall, 3'-fluoro-2,6-diaminopurine-2',3'-dideoxyriboside represents a significant area of interest in medicinal chemistry and virology.
Formula:C10H13FN6O2
InChI:InChI=1/C10H13FN6O2/c11-4-1-6(19-5(4)2-18)17-3-14-7-8(12)15-10(13)16-9(7)17/h3-6,18H,1-2H2,(H4,12,13,15,16)/t4-,5+,6+/m0/s1
Synonyms:- 3'-Fluoro-2-amino-2',3'-dideoxyadenosine
- Fdddapr
- Adenosine, 2-amino-2',3'-dideoxy-3'-fluoro-
- 9-[(3xi)-2,3-dideoxy-3-fluoro-beta-D-glycero-pentofuranosyl]-9H-purine-2,6-diamine
- 2-Amino-2',3'-Dideoxy-3'-Fluoroadenosine
- 3'-Fluoro-2,6-diaminopurine-2',3'-dideoxyriboside
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
