CAS 1147548-83-1
:N,N′′′-1,2-Ethanediylbis[N′-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine]
Description:
N,N′′′-1,2-Ethanediylbis[N′-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine], identified by its CAS number 1147548-83-1, is a synthetic organic compound characterized by its complex structure, which includes a central ethanediyl group linking two guanidine moieties. Each guanidine unit is substituted with a 5-chloro-2,1,3-benzothiadiazole group, contributing to its potential biological activity. The presence of the benzothiadiazole moiety suggests that the compound may exhibit properties relevant to pharmaceuticals or agrochemicals, particularly in terms of antimicrobial or herbicidal activity. The chlorine substituent can influence the compound's reactivity and solubility. Additionally, the guanidine functional groups are known for their basicity and ability to form hydrogen bonds, which may enhance the compound's interactions with biological targets. Overall, this compound's unique structural features position it as a candidate for further research in medicinal chemistry and related fields. However, specific data regarding its physical properties, toxicity, and applications would require empirical investigation.
Formula:C16H14Cl2N10S2
InChI:InChI=1S/C16H14Cl2N10S2/c17-7-1-3-9-13(27-29-25-9)11(7)23-15(19)21-5-6-22-16(20)24-12-8(18)2-4-10-14(12)28-30-26-10/h1-4H,5-6H2,(H3,19,21,23)(H3,20,22,24)
InChI key:InChIKey=QIINEHUBJQVURQ-UHFFFAOYSA-N
SMILES:N(C(NCCNC(NC=1C=2C(C=CC1Cl)=NSN2)=N)=N)C=3C=4C(C=CC3Cl)=NSN4
Synonyms:- N,N′′′-1,2-Ethanediylbis[N′-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine]
- Guanidine, N,N′′′-1,2-ethanediylbis[N′-(5-chloro-2,1,3-benzothiadiazol-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Tizanidine EP Impurity C
CAS:Formula:C16H14Cl2N10O2Color and Shape:Yellow SolidMolecular weight:481.38N,N’’’-1,2-Ethanediylbis[N’-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine]
CAS:Controlled ProductApplications N,N’’’-1,2-Ethanediylbis[N’-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine] is an impurity of Tizanidine Hydrochloride (T449500), an α2-adrenergic agonist.
References Reddy, Ghanta M., et al.: Analytical Chem.: An Indian J., 7(8), 586-590 (2008)Formula:C16H14Cl2N10S2Color and Shape:NeatMolecular weight:481.385


