CAS 1147557-75-2
:2,5-Difluoro-4-(methylsulfonyl)benzenamine
Description:
2,5-Difluoro-4-(methylsulfonyl)benzenamine is an organic compound characterized by the presence of a benzene ring substituted with two fluorine atoms and a methylsulfonyl group, along with an amino group. The fluorine atoms are located at the 2 and 5 positions of the benzene ring, while the methylsulfonyl group is attached at the 4 position, and the amino group is at the 1 position. This compound is typically a solid at room temperature and is soluble in polar organic solvents due to the presence of the sulfonyl and amino functional groups. Its structure suggests potential applications in pharmaceuticals and agrochemicals, particularly due to the reactivity of the amino group and the influence of the fluorine substituents on biological activity. The presence of the methylsulfonyl group may enhance solubility and bioavailability. As with many fluorinated compounds, it may exhibit unique properties such as increased stability and altered lipophilicity, making it of interest in various chemical and biological research fields.
Formula:C7H7F2NO2S
InChI:InChI=1S/C7H7F2NO2S/c1-13(11,12)7-3-4(8)6(10)2-5(7)9/h2-3H,10H2,1H3
InChI key:InChIKey=YFHKCMZYVVBUFC-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(F)C=C(N)C(F)=C1
Synonyms:- 2,5-Difluoro-4-methanesulfonylaniline
- Benzenamine, 2,5-difluoro-4-(methylsulfonyl)-
- 2,5-Difluoro-4-(methylsulfonyl)aniline
- 2,5-Difluoro-4-methylsulfonylaniline
- 2,5-Difluoro-4-(methylsulfonyl)benzenamine
- 2,5-Difluoro-4-methanesulfonyl-phenylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,5-Difluoro-4-methanesulfonylaniline
CAS:<p>2,5-Difluoro-4-methanesulfonylaniline</p>Molecular weight:207.19779g/mol


