CymitQuimica logo

CAS 1147557-98-9

:

6-(Phenylmethoxy)-2-azaspiro[3.3]heptane

Description:
6-(Phenylmethoxy)-2-azaspiro[3.3]heptane is a chemical compound characterized by its unique spirocyclic structure, which features a nitrogen atom incorporated into a bicyclic framework. This compound contains a phenylmethoxy group, contributing to its potential for various interactions due to the presence of the aromatic ring. The spirocyclic nature of the molecule often imparts interesting conformational properties and can influence its biological activity. The azaspiro structure suggests that it may exhibit properties relevant to medicinal chemistry, potentially acting as a ligand for various biological targets. Additionally, the presence of the phenylmethoxy group may enhance lipophilicity, affecting its solubility and permeability in biological systems. As with many organic compounds, the specific reactivity and stability of 6-(Phenylmethoxy)-2-azaspiro[3.3]heptane can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a class of molecules that may have applications in drug discovery and development, particularly in the fields of neuropharmacology and medicinal chemistry.
Formula:C13H17NO
InChI:InChI=1S/C13H17NO/c1-2-4-11(5-3-1)8-15-12-6-13(7-12)9-14-10-13/h1-5,12,14H,6-10H2
InChI key:InChIKey=DZYPAQIYPIBEFQ-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2CC3(C2)CNC3
Synonyms:
  • 2-Azaspiro[3.3]heptane, 6-(phenylmethoxy)-
  • 6-(Phenylmethoxy)-2-azaspiro[3.3]heptane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.