CymitQuimica logo

CAS 1147558-10-8

:

4-(Cyclopropylsulfonyl)-2-fluorophenol

Description:
4-(Cyclopropylsulfonyl)-2-fluorophenol is an organic compound characterized by its unique functional groups and structural features. It contains a fluorophenol moiety, which contributes to its potential reactivity and solubility properties. The presence of a cyclopropylsulfonyl group enhances its chemical stability and may influence its biological activity. This compound is likely to exhibit polar characteristics due to the sulfonyl and hydroxyl groups, which can engage in hydrogen bonding. Additionally, the fluorine atom can affect the electronic properties, potentially increasing lipophilicity and altering the compound's interaction with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such modifications can enhance efficacy and selectivity. As with many sulfonyl-containing compounds, it may also exhibit interesting properties in terms of reactivity and stability under various conditions. Overall, 4-(Cyclopropylsulfonyl)-2-fluorophenol represents a versatile scaffold for further chemical exploration and application in various fields.
Formula:C9H9FO3S
InChI:InChI=1S/C9H9FO3S/c10-8-5-7(3-4-9(8)11)14(12,13)6-1-2-6/h3-6,11H,1-2H2
InChI key:InChIKey=JFCAYTVCMDSFOS-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC(F)=C(O)C=C1)C2CC2
Synonyms:
  • Phenol, 4-(cyclopropylsulfonyl)-2-fluoro-
  • 4-(Cyclopropylsulfonyl)-2-fluorophenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.