
CAS 1147558-11-9
:2-Chloro-4-(cyclopropylsulfonyl)phenol
Description:
2-Chloro-4-(cyclopropylsulfonyl)phenol is an organic compound characterized by its phenolic structure, which includes a chlorine atom and a cyclopropylsulfonyl group attached to the aromatic ring. The presence of the chlorine substituent typically enhances the compound's reactivity and can influence its biological activity. The cyclopropylsulfonyl group introduces unique steric and electronic properties, potentially affecting the compound's solubility and interaction with biological targets. This compound may exhibit antimicrobial or antifungal properties, making it of interest in pharmaceutical research. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the sulfonyl group can enhance the compound's stability and solubility in polar solvents. As with many phenolic compounds, it may also exhibit antioxidant properties. Safety and handling precautions should be observed due to the potential toxicity associated with chlorinated compounds and sulfonyl groups. Overall, 2-Chloro-4-(cyclopropylsulfonyl)phenol represents a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C9H9ClO3S
InChI:InChI=1S/C9H9ClO3S/c10-8-5-7(3-4-9(8)11)14(12,13)6-1-2-6/h3-6,11H,1-2H2
InChI key:InChIKey=FUVBYNIIISJPNI-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC(Cl)=C(O)C=C1)C2CC2
Synonyms:- 2-Chloro-4-(cyclopropylsulfonyl)phenol
- 2-Chloro-4-(cyclopropanesulfonyl)phenol
- Phenol, 2-chloro-4-(cyclopropylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.