
CAS 1147558-12-0
:2-Chloro-4-(cyclopropylsulfonyl)benzenamine
Description:
2-Chloro-4-(cyclopropylsulfonyl)benzenamine is an organic compound characterized by its aromatic structure, featuring a chloro substituent and a cyclopropylsulfonyl group attached to a benzene ring. The presence of the chloro group introduces a halogen, which can influence the compound's reactivity and polarity. The cyclopropylsulfonyl moiety contributes to the compound's unique properties, potentially affecting its solubility and interaction with biological targets. This compound may exhibit specific biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the sulfonyl group can enhance the compound's stability and solubility in polar solvents. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity. Overall, 2-Chloro-4-(cyclopropylsulfonyl)benzenamine represents a versatile structure with potential applications in pharmaceuticals and organic synthesis.
Formula:C9H10ClNO2S
InChI:InChI=1S/C9H10ClNO2S/c10-8-5-7(3-4-9(8)11)14(12,13)6-1-2-6/h3-6H,1-2,11H2
InChI key:InChIKey=JNORNSRSJMISKH-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC(Cl)=C(N)C=C1)C2CC2
Synonyms:- 2-Chloro-4-(cyclopropylsulfonyl)aniline
- 2-Chloro-4-(cyclopropylsulfonyl)benzenamine
- 2-Chloro-4-cyclopropylsulfonylaniline
- Benzenamine, 2-chloro-4-(cyclopropylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.