CymitQuimica logo

CAS 1147558-13-1

:

4-(Cyclopropylsulfonyl)benzenamine

Description:
4-(Cyclopropylsulfonyl)benzenamine is an organic compound characterized by the presence of a sulfonyl group attached to a cyclopropyl ring and an aniline moiety. This compound features a benzene ring substituted with an amino group and a cyclopropylsulfonyl group, which contributes to its unique chemical properties. The sulfonyl group enhances the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The cyclopropyl group can impart strain and influence the compound's steric and electronic properties, potentially affecting its biological activity. 4-(Cyclopropylsulfonyl)benzenamine may exhibit solubility in polar organic solvents and could be of interest in medicinal chemistry for its potential pharmacological applications. Its specific interactions and stability would depend on the surrounding conditions, such as pH and temperature. As with many organic compounds, safety precautions should be taken when handling this substance, and its properties should be further explored through experimental studies for comprehensive understanding.
Formula:C9H11NO2S
InChI:InChI=1S/C9H11NO2S/c10-7-1-3-8(4-2-7)13(11,12)9-5-6-9/h1-4,9H,5-6,10H2
InChI key:InChIKey=JRPZKEUELSTMFP-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC=C(N)C=C1)C2CC2
Synonyms:
  • Benzenamine, 4-(cyclopropylsulfonyl)-
  • 4-Cyclopropylsulfonylaniline
  • 4-(Cyclopropylsulfonyl)aniline
  • 4-(Cyclopropylsulfonyl)benzenamine
Found 5 products.