CAS 1147558-17-5

6-(Cyclopropylsulfonyl)-2-methyl-3-pyridinamine

Description:

6-(Cyclopropylsulfonyl)-2-methyl-3-pyridinamine is a chemical compound characterized by its unique structural features, including a pyridine ring substituted with a methyl group and a cyclopropylsulfonyl moiety. The presence of the sulfonyl group enhances its reactivity and solubility in various solvents, making it suitable for diverse applications in medicinal chemistry and drug development. This compound may exhibit biological activity due to its ability to interact with specific biological targets, potentially influencing pathways related to various diseases. Its molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which can affect its pharmacokinetic properties. Additionally, the cyclopropyl group may contribute to the compound's conformational flexibility, influencing its binding affinity and selectivity for target proteins. Overall, 6-(Cyclopropylsulfonyl)-2-methyl-3-pyridinamine represents a class of compounds that could be of interest in the development of therapeutic agents, particularly in the context of targeted therapies.

Formula: C₉H₁₂N₂O₂S

InChI: InChI=1S/C9H12N2O2S/c1-6-8(10)4-5-9(11-6)14(12,13)7-2-3-7/h4-5,7H,2-3,10H2,1H3

InChI key: InChIKey=KWFSJYCTOCNOHR-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C=1N=C(C)C(N)=CC1)C2CC2

Synonyms:

• 3-Pyridinamine, 6-(cyclopropylsulfonyl)-2-methyl-
• 6-(Cyclopropylsulfonyl)-2-methyl-3-pyridinamine