CAS 114763-28-9
:(1S,2R)-3-Ethenyl-3,5-cyclohexadiene-1,2-diol
Description:
(1S,2R)-3-Ethenyl-3,5-cyclohexadiene-1,2-diol, identified by its CAS number 114763-28-9, is a chemical compound characterized by its unique bicyclic structure that features both a diene and a diol functional group. This compound exhibits stereochemistry, indicated by its (1S,2R) configuration, which plays a crucial role in its reactivity and interaction with biological systems. The presence of the ethenyl group contributes to its potential as a reactive intermediate in various organic synthesis pathways. Additionally, the hydroxyl groups in the diol portion enhance its polarity, making it more soluble in polar solvents and potentially increasing its reactivity in nucleophilic substitution reactions. The compound may also exhibit interesting optical properties due to its stereogenic centers. Overall, (1S,2R)-3-Ethenyl-3,5-cyclohexadiene-1,2-diol is of interest in synthetic organic chemistry and may have applications in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further research into its properties and reactivity.
Formula:C8H10O2
InChI:InChI=1S/C8H10O2/c1-2-6-4-3-5-7(9)8(6)10/h2-5,7-10H,1H2/t7-,8+/m0/s1
InChI key:InChIKey=VQKKVCTZENPFCZ-JGVFFNPUSA-N
SMILES:C(=C)C=1[C@@H](O)[C@@H](O)C=CC1
Synonyms:- 3,5-Cyclohexadiene-1,2-diol, 3-ethenyl-, (1S-cis)-
- (1S,2R)-3-Ethenyl-3,5-cyclohexadiene-1,2-diol
- 3,5-Cyclohexadiene-1,2-diol, 3-ethenyl-, (1S,2R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
