CymitQuimica logo

CAS 114772-25-7

:

2-BUTYL-1H-IMIDAZOLE-4,5-DICARBONITRILE

Description:
2-Butyl-1H-imidazole-4,5-dicarbonitrile is a heterocyclic organic compound characterized by its imidazole ring structure, which contains two nitrogen atoms in a five-membered ring. The presence of two cyano groups (-C≡N) at the 4 and 5 positions of the imidazole ring contributes to its reactivity and potential applications in various chemical processes. The butyl group attached to the nitrogen enhances its solubility in organic solvents and may influence its biological activity. This compound is typically used in synthetic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a building block or intermediate in various reactions. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the substance. Safety data should be consulted for handling and storage, as compounds with cyano groups can be toxic and require appropriate precautions.
Formula:C9H10N4
InChI:InChI=1/C9H10N4/c1-2-3-4-9-12-7(5-10)8(6-11)13-9/h2-4H2,1H3,(H,12,13)
SMILES:CCCCc1nc(C#N)c(C#N)[nH]1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.