CAS 114772-36-0
:TERT-BUTYL 4'-METHYLBIPHENYL-2-CARBOXYLATE
Description:
Tert-Butyl 4'-methylbiphenyl-2-carboxylate, with the CAS number 114772-36-0, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The tert-butyl group contributes to its hydrophobic nature, while the carboxylate functional group enhances its reactivity and solubility in organic solvents. This compound typically exhibits a relatively high melting point and boiling point due to the presence of the bulky tert-butyl group, which can influence its physical properties. It is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals or agrochemicals. The presence of the methyl group on one of the phenyl rings can affect its electronic properties and steric hindrance, making it a subject of interest in studies related to molecular interactions and reactivity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C18H20O2
InChI:InChI=1/C18H20O2/c1-13-9-11-14(12-10-13)15-7-5-6-8-16(15)17(19)20-18(2,3)4/h5-12H,1-4H3
SMILES:Cc1ccc(cc1)c1ccccc1C(=O)OC(C)(C)C
Synonyms:- 4'-Methyl-Biphenyl-2-Carboxylic Acid Tert-Butyl Ester
- 4'-Methylbiphenyl-2-Tertiary Butyl Formate
- Tert-Butyl 4'-Methyl-[1,1'-Biphenyl]-2-Carboxylate
- 2-(p-Tolyl)-benzoic acid tert-butyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
tert-Butyl 4'-methylbiphenyl-2-carboxylate
CAS:Tert-Butyl 4'-methylbiphenyl-2-carboxylate is a versatile building block that can be used to synthesize complex compounds. It has CAS No. 114772-36-0 and is a fine chemical, which means it is not intended for use as a food additive, drug or cosmetic ingredient. Tert-Butyl 4'-methylbiphenyl-2-carboxylate is also a reagent, speciality chemical and useful scaffold for the synthesis of pharmaceuticals, pesticides and other chemicals.Formula:C18H20O2Purity:Min. 95%Color and Shape:Slightly Yellow PowderMolecular weight:268.35 g/mol

