CAS 114776-28-2
:Bepafant
Description:
Bepafant, with the CAS number 114776-28-2, is a chemical compound that has been studied primarily for its pharmacological properties. It is classified as a selective antagonist of the histamine H3 receptor, which plays a significant role in the regulation of neurotransmitter release in the central nervous system. This characteristic makes Bepafant of interest in the context of neurological research and potential therapeutic applications, particularly in conditions such as cognitive disorders and sleep-related issues. The compound is typically characterized by its ability to modulate histaminergic signaling, which can influence various physiological processes, including wakefulness and appetite. Additionally, Bepafant's chemical structure and properties may contribute to its efficacy and safety profile, making it a subject of ongoing research in medicinal chemistry. As with many pharmacological agents, understanding its mechanism of action, pharmacokinetics, and potential side effects is crucial for evaluating its therapeutic potential.
Formula:C23H22ClN5O2S
InChI:InChI=1/C23H22ClN5O2S/c1-13-26-27-19-12-25-21(15-4-2-3-5-17(15)24)20-16-10-14(11-18(16)32-23(20)29(13)19)22(30)28-6-8-31-9-7-28/h2-5,14H,6-12H2,1H3
InChI key:InChIKey=FWYVRZOREBYLCY-UHFFFAOYSA-N
SMILES:CC=1N2C3=C(C4=C(S3)CC(C(=O)N5CCOCC5)C4)C(=NCC2=NN1)C6=C(Cl)C=CC=C6
Synonyms:- (6-(2-Chlorophenyl)-1-methyl-4,7,8,9-tetrahydrocyclopenta[4,5]thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl)(morpholino)methanone
- 4-((6-(o-Chlorophenyl)-8,9-dihydro-1-methyl-4H,7H-cyclopenta(4,5)thieno(3,2-f)-s-triazolo(4,3-a)(1,4)diazepin-8-yl)carbonyl)morpholine
- 4H,7H-Cyclopenta[4,5]thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine, morpholine deriv.
- Bepafant [INN]
- Bepafanto
- Bepafanto [INN-Spanish]
- Methanone, [6-(2-chlorophenyl)-8,9-dihydro-1-methyl-4H,7H-cyclopenta[4,5]thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]-4-morpholinyl-
- Morpholine, 4-[[6-(2-chlorophenyl)-8,9-dihydro-1-methyl-4H,7H-cyclopenta[4,5]thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]carbonyl]-
- Unii-Cks724B66O
- Web 2170
- [6-(2-Chlorophenyl)-8,9-dihydro-1-methyl-4H,7H-cyclopenta[4,5]thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]-4-morpholinylmethanone
- [6-(2-chlorophenyl)-1-methyl-8,9-dihydro-4H,7H-cyclopenta[4,5]thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl](morpholin-4-yl)methanone
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Bepafant
CAS:Controlled ProductBepafant is an antagonist that binds to the platelet-activating factor receptor, which inhibits the activation of platelets and prevents their aggregation. Bepafant has been shown to be a potent inhibitor of atherosclerotic lesion formation in mice. The drug also has inhibitory effects on bowel disease, with a synergistic effect when used with pharmacological agents such as cyclooxygenase inhibitors or nonsteroidal anti-inflammatory drugs. Bepafant may also have antiplatelet properties and inhibit injury by inhibiting the production of dinucleotide phosphate in platelets.
Formula:C23H22ClN5O2SPurity:Min. 95%Molecular weight:467.97 g/molBepafant
CAS:Bepafant: a PAF antagonist with anti-inflammatory properties; induces apoptosis in PTEN-positive NB4, KG1, NB4-MR4 cells, not in PTEN-negative THP1, U937.Formula:C23H22ClN5O2SPurity:98%Color and Shape:SolidMolecular weight:467.97


