CAS 1147866-54-3
:(2E)-3-(Dimethylamino)-1-(4-fluoro-3-nitrophenyl)-2-propen-1-one
Description:
(2E)-3-(Dimethylamino)-1-(4-fluoro-3-nitrophenyl)-2-propen-1-one, identified by its CAS number 1147866-54-3, is an organic compound characterized by its conjugated system, which includes a propenone structure. This compound features a dimethylamino group, which contributes to its basicity and potential reactivity, as well as a 4-fluoro-3-nitrophenyl substituent that introduces both electron-withdrawing and electron-donating characteristics, influencing its electronic properties and reactivity. The presence of the nitro group enhances its polarity and may affect its solubility in various solvents. This compound is likely to exhibit significant biological activity due to its structural features, making it of interest in medicinal chemistry and material science. Its stability, reactivity, and potential applications can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, this compound's unique structural attributes position it as a candidate for further research in various chemical and pharmaceutical applications.
Formula:C11H11FN2O3
InChI:InChI=1S/C11H11FN2O3/c1-13(2)6-5-11(15)8-3-4-9(12)10(7-8)14(16)17/h3-7H,1-2H3/b6-5+
InChI key:InChIKey=DHTAANUIBJLGTQ-AATRIKPKSA-N
SMILES:C(/C=C/N(C)C)(=O)C1=CC(N(=O)=O)=C(F)C=C1
Synonyms:- (2E)-3-(Dimethylamino)-1-(4-fluoro-3-nitrophenyl)-2-propen-1-one
- 2-Propen-1-one, 3-(dimethylamino)-1-(4-fluoro-3-nitrophenyl)-, (2E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.