CymitQuimica logo

CAS 114787-83-6

:

N-BOC-3-(3-METHYL-4-NITROBENZYL)-L-

Description:
N-BOC-3-(3-METHYL-4-NITROBENZYL)-L- is a chemical compound characterized by its specific functional groups and structural features. The "N-BOC" (tert-butoxycarbonyl) group serves as a protecting group for the amine, enhancing the compound's stability and solubility in organic solvents. The presence of the 3-methyl-4-nitrobenzyl moiety contributes to its unique reactivity and potential applications in organic synthesis, particularly in the field of medicinal chemistry. This compound is typically used in peptide synthesis and other organic transformations due to its ability to undergo various reactions while maintaining the integrity of the BOC protecting group. Its molecular structure suggests that it may exhibit specific interactions with biological targets, making it of interest for drug development. Additionally, the nitro group can influence the electronic properties of the molecule, potentially affecting its reactivity and biological activity. Overall, N-BOC-3-(3-METHYL-4-NITROBENZYL)-L- is a versatile compound with applications in synthetic organic chemistry and pharmaceutical research.
Formula:C20H26N4O6
InChI:InChI=1/C20H26N4O6/c1-13-8-14(6-7-17(13)24(27)28)10-23-11-15(21-12-23)9-16(18(25)29-5)22-19(26)30-20(2,3)4/h6-8,11-12,16H,9-10H2,1-5H3,(H,22,26)/t16-/m0/s1
SMILES:Cc1cc(ccc1N(=O)=O)Cn1cc(C[C@@H](C(=O)OC)N=C(O)OC(C)(C)C)nc1
Synonyms:
  • N-Boc-3-(3-Methyl-4-Nitrobenzyl)-L-Histidi Ne Methyl Ester
  • methyl N-(tert-butoxycarbonyl)-1-(3-methyl-4-nitrobenzyl)-L-histidinate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.