CAS 114787-91-6
:4-METHOXY-3-METHYLBENZYL ALCOHOL
Description:
4-Methoxy-3-methylbenzyl alcohol, with the CAS number 114787-91-6, is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3) and a methyl group (-CH3) attached to a benzyl alcohol framework. This compound typically appears as a colorless to pale yellow liquid and is known for its pleasant, sweet odor, making it potentially useful in fragrance applications. It is soluble in organic solvents and exhibits moderate solubility in water due to the presence of the hydroxyl (-OH) group. The compound may participate in various chemical reactions, including oxidation and esterification, owing to its functional groups. Additionally, it may exhibit biological activity, which could be of interest in pharmaceutical or agrochemical research. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 4-methoxy-3-methylbenzyl alcohol represents a versatile compound with potential applications in multiple fields.
Formula:C9H12O2
InChI:InChI=1/C9H12O2/c1-7-5-8(6-10)3-4-9(7)11-2/h3-5,10H,6H2,1-2H3
SMILES:Cc1cc(ccc1OC)CO
Synonyms:- Rarechem Al Bd 0539
- (4-Methoxy-3-Methylphenyl)Methanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzenemethanol, 4-methoxy-3-methyl-
CAS:Formula:C9H12O2Purity:98%Color and Shape:LiquidMolecular weight:152.19044-Methoxy-3-methylbenzyl alcohol
CAS:4-Methoxy-3-methylbenzyl alcohol is a high quality and versatile chemical reagent. It is a complex compound with the CAS number 114787-91-6. 4-Methoxy-3-methylbenzyl alcohol is useful as an intermediate in the synthesis of other fine chemicals, such as pesticides, dyes, and pharmaceuticals. It is also used as a speciality chemical for research purposes or as a building block for more complicated compounds. This compound can be used in reactions to produce new products, such as reaction components that are versatile building blocks.Formula:C9H12O2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:152.19 g/mol


