
CAS 1147979-46-1
:3-Amino-4-hydroxybenzeneacetic acid hydrazide
Description:
3-Amino-4-hydroxybenzeneacetic acid hydrazide, identified by its CAS number 1147979-46-1, is a chemical compound that features both amino and hydroxy functional groups, contributing to its reactivity and potential biological activity. This compound is characterized by its hydrazide functional group, which is known for its ability to form hydrazones and its role in various chemical reactions, including condensation and coupling reactions. The presence of the amino group enhances its solubility in polar solvents, while the hydroxy group can participate in hydrogen bonding, influencing its physical properties and interactions. This compound may exhibit potential applications in pharmaceuticals, particularly in the development of drugs due to its structural features that can interact with biological targets. Additionally, its unique combination of functional groups may confer antioxidant or anti-inflammatory properties, making it a subject of interest in medicinal chemistry. However, specific studies and data on its biological activity and safety profile would be necessary to fully understand its potential applications and implications.
Formula:C8H11N3O2
InChI:InChI=1S/C8H11N3O2/c9-6-3-5(1-2-7(6)12)4-8(13)11-10/h1-3,12H,4,9-10H2,(H,11,13)
InChI key:InChIKey=ISHGZQJUJHROCS-UHFFFAOYSA-N
SMILES:C(C(NN)=O)C1=CC(N)=C(O)C=C1
Synonyms:- Benzeneacetic acid, 3-amino-4-hydroxy-, hydrazide
- 3-Amino-4-hydroxybenzeneacetic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.