CymitQuimica logo

CAS 1148-78-3

:

3-[3-(bis(2-fluoroethyl)amino)phenyl]propanoic acid

Description:
3-[3-(Bis(2-fluoroethyl)amino)phenyl]propanoic acid, with the CAS number 1148-78-3, is a chemical compound characterized by its structure, which includes a propanoic acid moiety linked to a phenyl ring that is further substituted with a bis(2-fluoroethyl)amino group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential hydrophilicity due to the carboxylic acid functional group and lipophilicity from the fluorinated ethyl groups. The presence of fluorine atoms can enhance the compound's stability and influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific solubility characteristics in various solvents, depending on the balance between its hydrophilic and lipophilic components. Its potential applications could span pharmaceuticals, agrochemicals, or materials science, where the unique properties imparted by the fluorinated groups may be advantageous. As with any chemical substance, safety and handling precautions should be observed due to its potential reactivity and biological effects.
Formula:C13H17F2NO2
InChI:InChI=1/C13H17F2NO2/c14-6-8-16(9-7-15)12-3-1-2-11(10-12)4-5-13(17)18/h1-3,10H,4-9H2,(H,17,18)
SMILES:c1cc(CCC(=O)O)cc(c1)N(CCF)CCF
Synonyms:
  • Hydrocinnamic acid, m-(bis(2-fluoroethyl)amino)-
  • Brn 2812522
  • Nsc 77491
  • m-(Bis(2-fluoroethyl)amino)hydrocinnamic acid
  • 3-{3-[bis(2-fluoroethyl)amino]phenyl}propanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.