CymitQuimica logo

CAS 1148027-07-9

:

5-(3-Bromophenyl)-2,3-pyrazinedicarboxylic acid

Description:
5-(3-Bromophenyl)-2,3-pyrazinedicarboxylic acid is an organic compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms at non-adjacent positions. The presence of the 3-bromophenyl group introduces a bromine substituent on the phenyl ring, enhancing the compound's reactivity and potential for various applications in organic synthesis and medicinal chemistry. The two carboxylic acid functional groups (-COOH) at the 2 and 3 positions of the pyrazine ring contribute to its acidity and solubility in polar solvents, making it useful in various chemical reactions, including esterification and amidation. This compound may exhibit interesting biological activities due to its structural features, which can influence interactions with biological targets. Additionally, the bromine atom can serve as a site for further functionalization, allowing for the development of derivatives with tailored properties. Overall, 5-(3-Bromophenyl)-2,3-pyrazinedicarboxylic acid is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C12H7BrN2O4
InChI:InChI=1S/C12H7BrN2O4/c13-7-3-1-2-6(4-7)8-5-14-9(11(16)17)10(15-8)12(18)19/h1-5H,(H,16,17)(H,18,19)
InChI key:InChIKey=KLBAHSNTSXLUIH-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N=C(C=NC1C(O)=O)C2=CC(Br)=CC=C2
Synonyms:
  • 2,3-Pyrazinedicarboxylic acid, 5-(3-bromophenyl)-
  • 5-(3-Bromophenyl)-2,3-pyrazinedicarboxylic acid
  • 5-(3-Bromo-phenyl)-pyrazine-2,3-dicarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.