CAS 1148027-11-5

2-(Methylthio)[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxaldehyde

Description:

2-(Methylthio)[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxaldehyde is a heterocyclic compound characterized by the presence of a triazole ring fused to a pyrimidine structure, along with a methylthio group and an aldehyde functional group. This compound typically exhibits properties associated with both triazoles and pyrimidines, such as potential biological activity, including antimicrobial or antitumor effects. The methylthio group can enhance lipophilicity, influencing the compound's solubility and permeability, which is crucial for pharmacological applications. The aldehyde functional group is reactive, allowing for further chemical modifications or interactions with biological targets. This compound may also participate in various chemical reactions, such as condensation or nucleophilic addition, due to the presence of the aldehyde. Its unique structure and functional groups make it of interest in medicinal chemistry and drug development, particularly in the search for novel therapeutic agents. As with many heterocycles, its stability and reactivity can be influenced by environmental conditions such as pH and temperature.

Formula: C₇H₆N₄OS

InChI: InChI=1S/C7H6N4OS/c1-13-7-9-6-8-2-5(4-12)3-11(6)10-7/h2-4H,1H3

InChI key: InChIKey=MBQBMKOFQJQZJJ-UHFFFAOYSA-N

SMILES: S(C)C1=NN2C(=N1)N=CC(C=O)=C2

Synonyms:

• 2-(Methylthio)[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxaldehyde
• [1,2,4]Triazolo[1,5-a]pyrimidine-6-carboxaldehyde, 2-(methylthio)-
• 2-Methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbaldehyde