CAS 1148027-21-7

3-[2-(Trimethylsilyl)ethynyl]imidazo[1,2-a]pyridine

Description:

3-[2-(Trimethylsilyl)ethynyl]imidazo[1,2-a]pyridine is a chemical compound characterized by its unique structure, which includes an imidazo[1,2-a]pyridine core and a trimethylsilyl-ethynyl substituent. This compound typically exhibits properties associated with both heterocyclic compounds and organosilicon chemistry. The presence of the imidazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The trimethylsilyl group enhances its stability and solubility in organic solvents, which can be advantageous for various synthetic applications. Additionally, the ethynyl group may facilitate further functionalization, allowing for the development of derivatives with tailored properties. The compound's reactivity can be influenced by the electronic effects of the silyl group, making it a valuable intermediate in organic synthesis. Overall, 3-[2-(Trimethylsilyl)ethynyl]imidazo[1,2-a]pyridine is a versatile compound with potential applications in pharmaceuticals and materials science.

Formula: C₁₂H₁₄N₂Si

InChI: InChI=1S/C12H14N2Si/c1-15(2,3)9-7-11-10-13-12-6-4-5-8-14(11)12/h4-6,8,10H,1-3H3

InChI key: InChIKey=OWDSIDOCUBKBCZ-UHFFFAOYSA-N

SMILES: C(#C[Si](C)(C)C)C=1N2C(=NC1)C=CC=C2

Synonyms:

• 2-Imidazo[1,2-a]pyridin-3-ylethynyl(trimethyl)silane
• 3-[(Trimethylsilyl)ethynyl]imidazo[1,2-a]pyridine
• Imidazo[1,2-a]pyridine, 3-[2-(trimethylsilyl)ethynyl]-
• 3-[2-(Trimethylsilyl)ethynyl]imidazo[1,2-a]pyridine