CAS 1148027-24-0
:2-Chloro-6-(3-chloro-2-pyrazinyl)-3-pyridinecarbonitrile
Description:
2-Chloro-6-(3-chloro-2-pyrazinyl)-3-pyridinecarbonitrile is a chemical compound characterized by its complex structure, which includes a pyridine ring and a pyrazine moiety. This compound features a chloro substituent at the 2-position of the pyridine ring and another chloro group at the 3-position of the pyrazine ring, contributing to its unique reactivity and potential biological activity. The presence of the cyano group (carbonitrile) at the 3-position of the pyridine enhances its electron-withdrawing properties, which can influence its interaction with biological targets. This compound may exhibit properties such as antimicrobial or antitumor activity, making it of interest in pharmaceutical research. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors in its application. As with many halogenated compounds, it is essential to consider its environmental impact and potential toxicity in various applications. Overall, 2-Chloro-6-(3-chloro-2-pyrazinyl)-3-pyridinecarbonitrile represents a significant compound for further investigation in medicinal chemistry.
Formula:C10H4Cl2N4
InChI:InChI=1S/C10H4Cl2N4/c11-9-6(5-13)1-2-7(16-9)8-10(12)15-4-3-14-8/h1-4H
InChI key:InChIKey=HENYEUUSPKHMGW-UHFFFAOYSA-N
SMILES:ClC=1C(C=2N=C(Cl)C(C#N)=CC2)=NC=CN1
Synonyms:- 3-Pyridinecarbonitrile, 2-chloro-6-(3-chloro-2-pyrazinyl)-
- 2-Chloro-6-(3-chloro-2-pyrazinyl)-3-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.