CAS 1148027-25-1
:3-(4-Fluorophenyl)-1-(2-nitrophenyl)piperazine
Description:
3-(4-Fluorophenyl)-1-(2-nitrophenyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 4-fluorophenyl group and a 2-nitrophenyl group, contributing to its unique chemical properties and potential biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. The nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity and stability. This substance may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its molecular structure suggests potential applications in areas such as neuropharmacology or as a scaffold for further chemical modifications. As with many piperazine derivatives, it may interact with various neurotransmitter systems, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C16H16FN3O2
InChI:InChI=1S/C16H16FN3O2/c17-13-7-5-12(6-8-13)14-11-19(10-9-18-14)15-3-1-2-4-16(15)20(21)22/h1-8,14,18H,9-11H2
InChI key:InChIKey=BQKXNYJJHVVFJC-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=CC=C1)N2CC(NCC2)C3=CC=C(F)C=C3
Synonyms:- Piperazine, 3-(4-fluorophenyl)-1-(2-nitrophenyl)-
- 3-(4-Fluorophenyl)-1-(2-nitrophenyl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.