CAS 1148027-29-5
:9a-(4-Fluorophenyl)octahydro-7H-pyrrolo[1,2-a][1,3]diazepin-7-one
Description:
9a-(4-Fluorophenyl)octahydro-7H-pyrrolo[1,2-a][1,3]diazepin-7-one is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrolidine and diazepine moiety. The presence of a 4-fluorophenyl group indicates that it has a fluorine atom substituted on a phenyl ring, which can influence its electronic properties and biological activity. This compound is likely to exhibit a range of pharmacological effects due to its structural features, which may interact with various biological targets. Its octahydro configuration suggests it is saturated, contributing to its stability and solubility in organic solvents. The compound's unique structure may also confer specific stereochemical properties, which can be crucial for its activity in medicinal chemistry. As with many compounds in this class, it may be of interest in drug discovery and development, particularly in the context of neuropharmacology or as a potential therapeutic agent. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C14H17FN2O
InChI:InChI=1S/C14H17FN2O/c15-12-5-3-11(4-6-12)14-8-7-13(18)17(14)10-2-1-9-16-14/h3-6,16H,1-2,7-10H2
InChI key:InChIKey=VQQQFIOKECOMGG-UHFFFAOYSA-N
SMILES:O=C1N2C(CC1)(NCCCC2)C3=CC=C(F)C=C3
Synonyms:- 9a-(4-Fluorophenyl)octahydro-7H-pyrrolo[1,2-a][1,3]diazepin-7-one
- 7H-Pyrrolo[1,2-a][1,3]diazepin-7-one, 9a-(4-fluorophenyl)octahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.