CAS 1148044-27-2: 1-(1,1-Dimethylethyl) 2-methyl 2-(2-oxoethyl)-1,2-azetidinedicarboxylate

Description:1-(1,1-Dimethylethyl) 2-methyl 2-(2-oxoethyl)-1,2-azetidinedicarboxylate, with the CAS number 1148044-27-2, is a chemical compound characterized by its unique azetidine ring structure, which is a four-membered cyclic amine. This compound features two carboxylate groups, contributing to its potential as a versatile building block in organic synthesis. The presence of the tert-butyl group (1,1-dimethylethyl) and the methyl group enhances its steric properties, which can influence its reactivity and interactions with other molecules. Additionally, the ketone functionality (2-oxoethyl) suggests potential for further chemical transformations, making it of interest in medicinal chemistry and materials science. Its solubility, stability, and reactivity profile would depend on the specific conditions, such as solvent and temperature. Overall, this compound's structural features may provide avenues for applications in drug development or as an intermediate in synthetic pathways.

Formula:C₁₂H₁₉NO₅

InChI:InChI=1S/C12H19NO5/c1-11(2,3)18-10(16)13-7-5-12(13,6-8-14)9(15)17-4/h8H,5-7H2,1-4H3

InChI key:InChIKey=UJABNRTXRMMUMS-UHFFFAOYSA-N

SMILES:O=CCC1(C(=O)OC)N(C(=O)OC(C)(C)C)CC1

Synonyms:
1-tert-Butyl 2-methyl 2-(2-oxoethyl)azetidine-1,2-dicarboxylate
1-(1,1-Dimethylethyl) 2-methyl 2-(2-oxoethyl)-1,2-azetidinedicarboxylate
1,2-Azetidinedicarboxylic acid, 2-(2-oxoethyl)-, 1-(1,1-dimethylethyl) 2-methyl ester

Found 3 products.

Product data	Purity	Price range	Estimated delivery
1,2-Azetidinedicarboxylic acid, 2-(2-oxoethyl)-, 1-(1,1-dimethylethyl) 2-methyl ester REF: IN-DA000F8OCAS: 1148044-27-2	- - -	To inquire	Mon 07 Apr 25
1-tert-butyl 2-methyl 2-(2-oxoethyl)azetidine-1,2-dicarboxylate REF: 10-F622757CAS: 1148044-27-2	95+%	- - -	Discontinued product
1-tert-Butyl 2-methyl 2-(2-oxoethyl)azetidine-1,2-dicarboxylate REF: 3D-YVB04427CAS: 1148044-27-2	Min. 95%	- - -	Discontinued product