
CAS 1148044-27-2
:1-(1,1-Dimethylethyl) 2-methyl 2-(2-oxoethyl)-1,2-azetidinedicarboxylate
Description:
1-(1,1-Dimethylethyl) 2-methyl 2-(2-oxoethyl)-1,2-azetidinedicarboxylate, with the CAS number 1148044-27-2, is a chemical compound characterized by its unique azetidine ring structure, which is a four-membered cyclic amine. This compound features two carboxylate groups, contributing to its potential as a versatile building block in organic synthesis. The presence of the tert-butyl group (1,1-dimethylethyl) and the methyl group enhances its steric properties, which can influence its reactivity and interactions with other molecules. Additionally, the ketone functionality (2-oxoethyl) suggests potential for further chemical transformations, making it of interest in medicinal chemistry and materials science. Its solubility, stability, and reactivity profile would depend on the specific conditions, such as solvent and temperature. Overall, this compound's structural features may provide avenues for applications in drug development or as an intermediate in synthetic pathways.
Formula:C12H19NO5
InChI:InChI=1S/C12H19NO5/c1-11(2,3)18-10(16)13-7-5-12(13,6-8-14)9(15)17-4/h8H,5-7H2,1-4H3
InChI key:InChIKey=UJABNRTXRMMUMS-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1(CC=O)N(C(OC(C)(C)C)=O)CC1
Synonyms:- 1-tert-Butyl 2-methyl 2-(2-oxoethyl)azetidine-1,2-dicarboxylate
- 1-(1,1-Dimethylethyl) 2-methyl 2-(2-oxoethyl)-1,2-azetidinedicarboxylate
- 1,2-Azetidinedicarboxylic acid, 2-(2-oxoethyl)-, 1-(1,1-dimethylethyl) 2-methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-tert-Butyl 2-methyl 2-(2-oxoethyl)azetidine-1,2-dicarboxylate
CAS:Formula:C12H19NO5Molecular weight:257.2830
