CAS 114812-34-9
:(S)-(-)-1-Ethyl-2-pyrrolidinecarboxamide
Description:
(S)-(-)-1-Ethyl-2-pyrrolidinecarboxamide, with the CAS number 114812-34-9, is a chiral organic compound characterized by its pyrrolidine ring structure, which contributes to its unique stereochemistry. This compound features an ethyl group and a carboxamide functional group, which influence its solubility and reactivity. Typically, compounds of this nature exhibit moderate polarity due to the presence of the amide group, allowing for potential hydrogen bonding interactions. The stereochemistry indicated by the (S)- designation suggests that it has specific spatial arrangements that can affect its biological activity and interaction with other molecules, making it of interest in pharmaceutical applications. Additionally, the compound's properties may include a relatively low melting point and a specific range of solubility in polar solvents, which are common characteristics of amides. Its potential applications could span various fields, including medicinal chemistry, where it may serve as a building block for drug development or as a ligand in coordination chemistry.
Formula:C7H14N2O
InChI:InChI=1/C7H14N2O/c1-2-9-5-3-4-6(9)7(8)10/h6H,2-5H2,1H3,(H2,8,10)/t6-/m0/s1
SMILES:CCN1CCC[C@H]1C(=N)O
Synonyms:- 1-ethyl-L-prolinamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Pyrrolidinecarboxamide, 1-ethyl-, (2S)-
CAS:Formula:C7H14N2OPurity:98%Color and Shape:SolidMolecular weight:142.1989(S)-(-)-1-Ethyl-2-pyrrolidinecarboxamide
CAS:(S)-(-)-1-Ethyl-2-pyrrolidinecarboxamidePurity:95%Molecular weight:142.20g/mol(S)-(-)-1-Ethyl-2-pyrrolidinecarboxamide
CAS:Formula:C7H14N2OPurity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:142.20(S)-1-Ethyl-2-pyrrolidinecarboxamide-d5
CAS:Controlled ProductApplications (S)-1-Ethyl-2-pyrrolidinecarboxamide-d5 is an isotope labelled substituent in the synthesis of various pyrrolidine based derivatives.
References Alberg, D., et al.: Bioorg. Med. Chem. Lett., 19, 3888 (2009), Huang, X., et al.: J. Phys. Chem., 114, 1068 (2010),Formula:C7D5H9N2OColor and Shape:NeatMolecular weight:147.23(S)-(-)-1-Ethyl-2-pyrrolidinecarboxamide
CAS:Formula:C7H14N2OPurity:98.0%Color and Shape:SolidMolecular weight:142.202




